Alkenes: Electrophilic Addition, Markovnikov's Rule, Peroxide Effect, and Polymerization
Introduction to Alkenes
Alkenes are unsaturated hydrocarbons characterized by the presence of at least one carbon-carbon double bond (C=C). This double bond consists of one sigma (σ) bond and one pi (π) bond. The pi bond is weaker and more exposed than the sigma bond, making it the site of chemical reactivity. Alkenes are fundamental building blocks in organic chemistry and serve as precursors for a vast array of organic compounds.
The general formula for a non-cyclic alkene with one double bond is CnH2n. For example, ethene (C2H4) is the simplest alkene, followed by propene (C3H6), butene (C4H8), and so on. The presence of the pi bond dictates their characteristic reactions, primarily addition reactions.
Electrophilic Addition Reactions of Alkenes
The most significant reaction of alkenes is electrophilic addition. In this type of reaction, the pi bond breaks, and new sigma bonds are formed with atoms from an incoming reagent. The mechanism typically involves the attack of an electrophile (an electron-seeking species) on the electron-rich pi bond of the alkene. This forms a carbocation intermediate, which is then attacked by a nucleophile.
The general mechanism for electrophilic addition to an alkene can be broken down into two main steps:
- Step 1: Electrophilic Attack and Carbocation Formation
The pi electrons of the alkene attack the electrophile (E+). This breaks the pi bond and forms a new sigma bond between one of the alkene carbons and the electrophile. The other alkene carbon becomes positively charged, forming a carbocation intermediate.
C=C + E+ → C+-C-E
- Step 2: Nucleophilic Attack
A nucleophile (Nu-), which is an electron-rich species, attacks the positively charged carbocation. This forms a new sigma bond, resulting in the addition product.
C+-C-E + Nu- → Nu-C-C-E
Examples of Electrophilic Addition Reactions:
- Addition of Hydrogen Halides (HX): Alkenes react with hydrogen halides (like HCl, HBr, HI) to form alkyl halides. For example, ethene reacts with HBr to form bromoethane.
CH2=CH2 + HBr → CH3-CH2Br
- Addition of Halogens (X2): Alkenes react with halogens (like Br2, Cl2) in an inert solvent (like CCl4) to form vicinal dihalides. The reaction proceeds via a cyclic halonium ion intermediate.
CH2=CH2 + Br2 → CH2Br-CH2Br
- Addition of Water (Hydration): In the presence of an acid catalyst (like H2SO4), alkenes react with water to form alcohols.
CH2=CH2 + H2O →H+ CH3-CH2OH
Markovnikov's Rule
When an unsymmetrical alkene reacts with a polar reagent (like HX, H2O), the addition of the hydrogen atom (the electropositive part of the reagent) occurs at the carbon atom of the double bond that already has the greater number of hydrogen atoms. Conversely, the halide or hydroxyl group (the electronegative part) attaches to the other carbon atom of the double bond, which is the more substituted carbon.
This rule is based on the stability of the carbocation intermediate formed during the reaction. When the electrophile adds to one carbon of the double bond, a carbocation is formed on the other carbon. More substituted carbocations are more stable due to hyperconjugation and inductive effects. Therefore, the addition that leads to the formation of the more stable carbocation is favored.
Explanation with an Example: Addition of HBr to Propene
Consider the reaction of propene (CH3-CH=CH2) with HBr.
There are two possible pathways for the addition of HBr:
- Path 1: H+ adds to C1 (CH2 end)
CH3-CH=CH2 + H+ → CH3-CH+-CH3 (Secondary carbocation - more stable)
This secondary carbocation is then attacked by Br- to form 2-bromopropane.
CH3-CH+-CH3 + Br- → CH3-CHBr-CH3 (Major product)
- Path 2: H+ adds to C2 (CH end)
CH3-CH=CH2 + H+ → CH3-CH2-CH2+ (Primary carbocation - less stable)
This primary carbocation is then attacked by Br- to form 1-bromopropane.
CH3-CH2-CH2+ + Br- → CH3-CH2-CH2Br (Minor product)
According to Markovnikov's rule, the major product is 2-bromopropane because the addition of H+ to the CH2 group leads to the formation of a more stable secondary carbocation (CH3-CH+-CH3). The addition of Br- then occurs at the C2 position.
Markovnikov's Rule Shortcut:
For unsymmetrical alkenes reacting with HX or H2O, remember: "The rich get richer." The carbon atom of the double bond with more hydrogen atoms gets the additional hydrogen atom.
Peroxide Effect (Anti-Markovnikov Addition)
While Markovnikov's rule predicts the major product in the addition of HBr to unsymmetrical alkenes under normal conditions, a significant exception occurs in the presence of organic peroxides (like benzoyl peroxide, (C6H5COO)2). In the presence of peroxides, the addition of HBr to unsymmetrical alkenes proceeds via an anti-Markovnikov pathway, yielding the opposite regiochemistry.
This phenomenon is known as the peroxide effect or the Kharasch effect. It is specific to the addition of HBr and does not occur with HCl or HI. The reason for this difference lies in the bond dissociation energies and the stability of the radical intermediates formed.
Mechanism of Anti-Markovnikov Addition (Free Radical Mechanism):
The addition of HBr in the presence of peroxides occurs via a free radical mechanism, which involves three stages:
- Initiation: Peroxides decompose upon heating or UV light to form alkoxy radicals. These radicals abstract a hydrogen atom from HBr to generate a bromine radical.
- (R-COO)2 → 2 R-COO•
- R-COO• → R• + CO2
- R• + H-Br → R-H + Br• (Bromine radical is the key chain carrier)
- Propagation: The bromine radical attacks the alkene. This addition occurs at the less substituted carbon atom of the double bond to form a more stable secondary alkyl radical. This alkyl radical then abstracts a hydrogen atom from another molecule of HBr, forming the anti-Markovnikov product and regenerating a bromine radical to continue the chain.
- Br• + CH3-CH=CH2 → CH3-CH•-CH2Br (Secondary radical - more stable)
- CH3-CH•-CH2Br + H-Br → CH3-CH2-CH2Br (Anti-Markovnikov product) + Br•
Note that if the bromine radical added to the more substituted carbon (CH), it would form a less stable primary radical (CH3-CHBr-CH2•), which is energetically unfavorable.
- Termination: The reaction stops when two radicals combine.
- Br• + Br• → Br2
- R• + Br• → R-Br
- R• + R• → R-R
Why only HBr?
The peroxide effect is observed only with HBr because the intermediate radicals formed during the propagation step are significantly different in stability compared to those formed with HCl or HI.
- HBr: The bromine radical (Br•) is a suitable chain carrier. The addition of Br• to the alkene forms a secondary alkyl radical, which is stable enough to abstract H from HBr. The reverse reaction (abstraction of Br from HBr by the alkyl radical) is also less favorable.
- HCl: The chlorine radical (Cl•) is smaller and more reactive. While it can add to the alkene, the reverse reaction (abstraction of Cl from HCl by the alkyl radical) is very fast, regenerating the chlorine radical and preventing product formation. Also, the bond dissociation energy of H-Cl is higher than H-Br, making the abstraction of H by Cl• less favorable.
- HI: The iodine radical (I•) is larger and less reactive. While it adds to the alkene, the resulting alkyl radical is less reactive. The reverse reaction (abstraction of I from HI by the alkyl radical) is very slow, but the abstraction of H from HI by the iodine radical is also very slow due to the weaker H-I bond. The product formed (alkyl iodide) can react with HI to regenerate the iodine radical (forming alkyl halide and H2), leading to an equilibrium that doesn't favor the addition product.
Peroxide Effect Shortcut:
Addition of HBr to unsymmetrical alkenes in the presence of peroxides leads to the Anti-Markovnikov product. Remember: "Peroxide reverses the rule!"
Example: Propene + HBr →Peroxides 1-bromopropane (Major product)
Polymerization of Alkenes
Polymerization is a process in which small monomer molecules (like alkenes) combine chemically to produce a large chain-like molecule, called a polymer. The repeating unit in the polymer is derived from the monomer.
Alkenes readily undergo polymerization, primarily through addition polymerization. This process involves the repeated addition of monomer units to a growing chain, usually initiated by free radicals, cations, or anions.
Types of Addition Polymerization:
- Free Radical Polymerization: This is the most common method for polymerizing alkenes like ethene and propene. It involves initiation, propagation, and termination steps, similar to the peroxide effect mechanism.
- Initiation: A free radical initiator (e.g., benzoyl peroxide) generates radicals that attack the alkene monomer.
- Propagation: The radical formed adds to another monomer, extending the polymer chain. This process repeats many times.
- Termination: The growing chains stop growing, typically by combination or disproportionation of two radical chains.
Example: Formation of Polyethene (Polyethylene)
Initiation: R• + CH2=CH2 → R-CH2-CH2•
Propagation: R-(CH2-CH2)n-CH2-CH2• + CH2=CH2 → R-(CH2-CH2)n+1-CH2-CH2•
Termination: Two growing chains combine.
The repeating unit is -[CH2-CH2]-. The polymer is represented as [CH2-CH2]n.
- Cationic Polymerization: Initiated by strong acids or Lewis acids (e.g., BF3, AlCl3) in the presence of a co-initiator like water. The mechanism involves carbocation intermediates. This method is suitable for monomers that can form stable carbocations, like isobutene.
Example: Formation of Polyisobutene
Initiation: H+ + CH2=C(CH3)2 → CH3-C+(CH3)2
Propagation: CH3-C+(CH3)2 + CH2=C(CH3)2 → CH3-C(CH3)2-CH2-C+(CH3)2
The repeating unit is -[CH2-C(CH3)2]-.
- Anionic Polymerization: Initiated by strong bases or nucleophiles (e.g., organometallic compounds like n-butyllithium). The mechanism involves carbanion intermediates. This method is suitable for monomers with electron-withdrawing groups attached to the double bond, or for monomers like butadiene.
Example: Polymerization of Vinyl Chloride
Initiation: BuLi + CH2=CHCl → Bu-CH2-CH(Li)Cl
Propagation: Bu-(CH2-CHCl)n-CH2-CH(Li)Cl + CH2=CHCl → Bu-(CH2-CHCl)n+1-CH2-CH(Li)Cl
The repeating unit is -[CH2-CHCl]-.
Examples of Polymers from Alkenes:
| Monomer | Polymer | Repeating Unit | Common Uses |
|---|---|---|---|
| Ethene (CH2=CH2) | Polyethene (Polyethylene) | -[CH2-CH2]- | Plastic bags, films, bottles, pipes |
| Propene (CH3-CH=CH2) | Polypropene (Polypropylene) | -[CH2-CH(CH3)]- | Fibers, ropes, containers, automotive parts |
| Vinyl Chloride (CH2=CHCl) | Polyvinyl Chloride (PVC) | -[CH2-CHCl]- | Pipes, window frames, flooring, cables |
| Styrene (C6H5-CH=CH2) | Polystyrene | -[CH2-CH(C6H5)]- | Insulation, packaging, disposable cups |
| Tetrafluoroethene (CF2=CF2) | Polytetrafluoroethene (PTFE, Teflon) | -[CF2-CF2]- | Non-stick cookware, electrical insulation |
Ziegler-Natta Polymerization
A significant advancement in alkene polymerization was the development of Ziegler-Natta catalysts. These catalysts, typically based on transition metal compounds (like titanium tetrachloride) and organoaluminum compounds, allow for the stereospecific polymerization of alkenes, particularly propene. This process yields highly crystalline polymers like isotactic polypropylene, which have superior mechanical properties compared to polymers obtained via free radical polymerization.
Ziegler-Natta polymerization leads to polymers with controlled stereochemistry (isotactic, syndiotactic, atactic), which significantly impacts their physical properties like melting point and tensile strength.
Importance and Applications
The reactions and polymerization of alkenes are of immense industrial importance. They form the basis for the production of a vast range of plastics, synthetic fibers, solvents, and intermediate chemicals used in pharmaceuticals, agriculture, and materials science. Understanding these reactions is crucial for comprehending modern organic synthesis and industrial chemistry.